Exalpha Laboratories manufactures the exalpha ramon-tsp reagents distributed by Genprice. The Exalpha Ramon-Tsp reagent is RUO (Research Use Only) to test human serum or cell culture lab samples. To purchase these products, for the MSDS, Data Sheet, protocol, storage conditions/temperature or for the concentration, please contact ExAlpha. Other Exalpha products are available in stock. Specificity: Exalpha Category: Ramon-Tsp
True Blue |
|
TargetMol Chemicals |
1mg |
Ask for price |
- SMILES: N=C(C1=CC=C(OC(/C=C/C2=CC3=CC(C(N)=N)=CC=C3O2)=C4)C4=C1)N.Cl.Cl
- Formula: C20H18Cl2N4O2
|
|
Description: True Blue |
True Blue |
|
TargetMol Chemicals |
50mg |
Ask for price |
- SMILES: N=C(C1=CC=C(OC(/C=C/C2=CC3=CC(C(N)=N)=CC=C3O2)=C4)C4=C1)N.Cl.Cl
- Formula: C20H18Cl2N4O2
|
|
Description: True Blue |
True Blue |
|
TargetMol Chemicals |
5mg |
Ask for price |
- SMILES: N=C(C1=CC=C(OC(/C=C/C2=CC3=CC(C(N)=N)=CC=C3O2)=C4)C4=C1)N.Cl.Cl
- Formula: C20H18Cl2N4O2
|
|
Description: True Blue |
JBS True Blue |
|
MiTeGen |
300 µl |
EUR 16 |
|
Description: JBS True Blue |
Test Assays information
Thrombospondin (TSP) |
|
MBS6508342-5x05mL |
MyBiosource |
5x0.5mL |
EUR 3330 |
tsp-21 Antibody |
|
CSB-PA883567XA01CXY-02mg |
Cusabio |
0.2mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-21 protein |
tsp-21 Antibody |
|
CSB-PA883567XA01CXY-10mg |
Cusabio |
10mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-21 protein |
tsp-17 Antibody |
|
CSB-PA606109XA01CXY-02mg |
Cusabio |
0.2mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-17 protein |
tsp-17 Antibody |
|
CSB-PA606109XA01CXY-10mg |
Cusabio |
10mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-17 protein |
tsp-14 Antibody |
|
CSB-PA150895XA01CXY-02mg |
Cusabio |
0.2mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-14 protein |
tsp-14 Antibody |
|
CSB-PA150895XA01CXY-10mg |
Cusabio |
10mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-14 protein |
tsp-15 Antibody |
|
CSB-PA910942XA01CXY-02mg |
Cusabio |
0.2mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-15 protein |
tsp-15 Antibody |
|
CSB-PA910942XA01CXY-10mg |
Cusabio |
10mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-15 protein |
tsp-12 Antibody |
|
CSB-PA981887XA01CXY-02mg |
Cusabio |
0.2mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-12 protein |
tsp-12 Antibody |
|
CSB-PA981887XA01CXY-10mg |
Cusabio |
10mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-12 protein |
tsp-1 Antibody |
|
CSB-PA025146XA01CXY-02mg |
Cusabio |
0.2mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-1 protein |
tsp-1 Antibody |
|
CSB-PA025146XA01CXY-10mg |
Cusabio |
10mg |
Ask for price |
- Enquire (Customer can provide a specific protein sequence for the antibody production and the price may vary depending on immunogen options)
|
|
Description: Recombinant Caenorhabditis elegans tsp-1 protein |
Thrombospondin 1 (THBS1, THBS, THBS-1, TSP, TSP-1, TSP1) (AP) |
|
MBS6440609-01mL |
MyBiosource |
0.1mL |
EUR 950 |
Thrombospondin 1 (THBS1, THBS, THBS-1, TSP, TSP-1, TSP1) (AP) |
|
MBS6440609-5x01mL |
MyBiosource |
5x0.1mL |
EUR 4120 |
Thrombospondin 1 (THBS1, THBS, THBS-1, TSP, TSP-1, TSP1) (PE) |
|
MBS6440619-01mL |
MyBiosource |
0.1mL |
EUR 950 |
Thrombospondin 1 (THBS1, THBS, THBS-1, TSP, TSP-1, TSP1) (PE) |
|
MBS6440619-5x01mL |
MyBiosource |
5x0.1mL |
EUR 4120 |